C22H26N2O3S — CID 31831964
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-ethyl-N-(2-methylprop-2-enyl)benzamide (PubChem CID 31831964) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-ethyl-N-(2-methylprop-2-enyl)benzamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-ethyl-N-(2-methylprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 31831964 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-ethyl-N-(2-methylprop-2-enyl)benzamide |
| SMILES | C=C(C)CN(CC)C(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C22H26N2O3S/c1-4-23(15-17(2)3)22(25)19-10-7-11-21(14-19)28(26,27)24-13-12-18-8-5-6-9-20(18)16-24/h5-11,14H,2,4,12-13,15-16H2,1,3H3 |
| InChIKey | BAOILZJNUBYCNC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|