C20H23N5O3S — CID 142402004
1-[(Z)-3-amino-2-methanimidoylprop-2-enyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]urea (PubChem CID 142402004) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-[(Z)-3-amino-2-methanimidoylprop-2-enyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]urea.
| Compound Name | 1-[(Z)-3-amino-2-methanimidoylprop-2-enyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 142402004 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[(Z)-3-amino-2-methanimidoylprop-2-enyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]urea |
| SMILES | [H]/N=C/C(=C\N)CNC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H23N5O3S/c21-11-15(12-22)13-23-20(26)24-18-5-7-19(8-6-18)29(27,28)25-10-9-16-3-1-2-4-17(16)14-25/h1-8,11-12,21H,9-10,13-14,22H2,(H2,23,24,26)/b15-12+,21-11+ |
| InChIKey | BVOFBSQSONKRAZ-NDNPDCFHSA-N |
| XLogP | 2.05 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|