C21H21N3O3S2 — CID 17266747
1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 17266747) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17266747 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)NCc2ccco2)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H21N3O3S2/c25-29(26,24-12-11-16-4-1-2-5-17(16)15-24)20-9-7-18(8-10-20)23-21(28)22-14-19-6-3-13-27-19/h1-10,13H,11-12,14-15H2,(H2,22,23,28) |
| InChIKey | BTEPXTFJHIZHKD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|