C22H16ClN3O4S — CID 162674851
4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-(3-methyl-2-pyridinyl)benzenesulfonamide (PubChem CID 162674851) has the molecular formula C22H16ClN3O4S and a molecular weight of 453.91 g/mol. Its IUPAC name is 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-(3-methyl-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-(3-methyl-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162674851 |
| Molecular Formula | C22H16ClN3O4S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-N-(3-methyl-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1cccnc1NS(=O)(=O)c1ccc(NC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H16ClN3O4S/c1-13-5-4-12-24-22(13)26-31(29,30)15-10-8-14(9-11-15)25-19-18(23)20(27)16-6-2-3-7-17(16)21(19)28/h2-12,25H,1H3,(H,24,26) |
| InChIKey | CWLHWKYEWBXGFC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|