C19H14ClF3N2O2 — CID 1033899
3-chloro-1-(2,3-dimethylphenyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione (PubChem CID 1033899) has the molecular formula C19H14ClF3N2O2 and a molecular weight of 394.78 g/mol. Its IUPAC name is 3-chloro-1-(2,3-dimethylphenyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(2,3-dimethylphenyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1033899 |
| Molecular Formula | C19H14ClF3N2O2 |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3-chloro-1-(2,3-dimethylphenyl)-4-[3-(trifluoromethyl)anilino]pyrrole-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C(Cl)=C(Nc3cccc(C(F)(F)F)c3)C2=O)c1C |
| InChI | InChI=1S/C19H14ClF3N2O2/c1-10-5-3-8-14(11(10)2)25-17(26)15(20)16(18(25)27)24-13-7-4-6-12(9-13)19(21,22)23/h3-9,24H,1-2H3 |
| InChIKey | NXWDFIGJGIVZKC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|