C26H19F3N2O5 — CID 1189957
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1189957) has the molecular formula C26H19F3N2O5 and a molecular weight of 496.44 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1189957 |
| Molecular Formula | C26H19F3N2O5 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cccc(N2C(=O)c3ccc(C(=O)OCC(=O)Nc4cccc(C(F)(F)F)c4)cc3C2=O)c1C |
| InChI | InChI=1S/C26H19F3N2O5/c1-14-5-3-8-21(15(14)2)31-23(33)19-10-9-16(11-20(19)24(31)34)25(35)36-13-22(32)30-18-7-4-6-17(12-18)26(27,28)29/h3-12H,13H2,1-2H3,(H,30,32) |
| InChIKey | DDRNBWBWOXPISS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|