C21H22N2O3 — CID 3872761
N-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]-3-methylbutanamide (PubChem CID 3872761) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]-3-methylbutanamide.
| Compound Name | N-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3872761 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]-3-methylbutanamide |
| SMILES | Cc1cccc(N2C(=O)c3ccc(NC(=O)CC(C)C)cc3C2=O)c1C |
| InChI | InChI=1S/C21H22N2O3/c1-12(2)10-19(24)22-15-8-9-16-17(11-15)21(26)23(20(16)25)18-7-5-6-13(3)14(18)4/h5-9,11-12H,10H2,1-4H3,(H,22,24) |
| InChIKey | CERBCOVVXIELAV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|