C30H25N3O3 — CID 108767308
2-(2,3-dimethylphenyl)-N-[2-(4-methylanilino)phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108767308) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-N-[2-(4-methylanilino)phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,3-dimethylphenyl)-N-[2-(4-methylanilino)phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108767308 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-N-[2-(4-methylanilino)phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(Nc2ccccc2NC(=O)c2ccc3c(c2)C(=O)N(c2cccc(C)c2C)C3=O)cc1 |
| InChI | InChI=1S/C30H25N3O3/c1-18-11-14-22(15-12-18)31-25-8-4-5-9-26(25)32-28(34)21-13-16-23-24(17-21)30(36)33(29(23)35)27-10-6-7-19(2)20(27)3/h4-17,31H,1-3H3,(H,32,34) |
| InChIKey | BDOAAQCDOLLZGK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|