C20H16F2N2O — CID 108745099
3,4-difluoro-N-[2-(4-methylanilino)phenyl]benzamide (PubChem CID 108745099) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-(4-methylanilino)phenyl]benzamide.
| Compound Name | 3,4-difluoro-N-[2-(4-methylanilino)phenyl]benzamide |
|---|---|
| PubChem CID | 108745099 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3,4-difluoro-N-[2-(4-methylanilino)phenyl]benzamide |
| SMILES | Cc1ccc(Nc2ccccc2NC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H16F2N2O/c1-13-6-9-15(10-7-13)23-18-4-2-3-5-19(18)24-20(25)14-8-11-16(21)17(22)12-14/h2-12,23H,1H3,(H,24,25) |
| InChIKey | KTZLZIYWCPLWCS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |