C21H19N5O3S — CID 108756481
2-(2,3-dimethylphenyl)-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108756481) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,3-dimethylphenyl)-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108756481 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCSc1n[nH]c(NC(=O)c2ccc3c(c2)C(=O)N(c2cccc(C)c2C)C3=O)n1 |
| InChI | InChI=1S/C21H19N5O3S/c1-4-30-21-23-20(24-25-21)22-17(27)13-8-9-14-15(10-13)19(29)26(18(14)28)16-7-5-6-11(2)12(16)3/h5-10H,4H2,1-3H3,(H2,22,23,24,25,27) |
| InChIKey | OMRAVHTXJMJQKT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|