C17H8ClF3N2O4 — CID 71561371
3-chloro-5-nitro-2-[4-(trifluoromethyl)anilino]naphthalene-1,4-dione (PubChem CID 71561371) has the molecular formula C17H8ClF3N2O4 and a molecular weight of 396.71 g/mol. Its IUPAC name is 3-chloro-5-nitro-2-[4-(trifluoromethyl)anilino]naphthalene-1,4-dione.
| Compound Name | 3-chloro-5-nitro-2-[4-(trifluoromethyl)anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 71561371 |
| Molecular Formula | C17H8ClF3N2O4 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 3-chloro-5-nitro-2-[4-(trifluoromethyl)anilino]naphthalene-1,4-dione |
| SMILES | O=C1C(Nc2ccc(C(F)(F)F)cc2)=C(Cl)C(=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C17H8ClF3N2O4/c18-13-14(22-9-6-4-8(5-7-9)17(19,20)21)15(24)10-2-1-3-11(23(26)27)12(10)16(13)25/h1-7,22H |
| InChIKey | FDCVNHANFVWHCF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|