C17H19ClN2O4 — CID 163260562
2-chloro-3-(heptylamino)-5-nitronaphthalene-1,4-dione (PubChem CID 163260562) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 2-chloro-3-(heptylamino)-5-nitronaphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(heptylamino)-5-nitronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 163260562 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-chloro-3-(heptylamino)-5-nitronaphthalene-1,4-dione |
| SMILES | CCCCCCCNC1=C(Cl)C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C17H19ClN2O4/c1-2-3-4-5-6-10-19-15-14(18)16(21)11-8-7-9-12(20(23)24)13(11)17(15)22/h7-9,19H,2-6,10H2,1H3 |
| InChIKey | YUTLSAHTXFOZRD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|