C24H21N5O7S2 — CID 25048263
3-morpholin-4-yl-1,4-dioxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]naphthalene-2-sulfonamide (PubChem CID 25048263) has the molecular formula C24H21N5O7S2 and a molecular weight of 555.59 g/mol. Its IUPAC name is 3-morpholin-4-yl-1,4-dioxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]naphthalene-2-sulfonamide.
| Compound Name | 3-morpholin-4-yl-1,4-dioxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25048263 |
| Molecular Formula | C24H21N5O7S2 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 3-morpholin-4-yl-1,4-dioxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCOCC2)=C(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H21N5O7S2/c30-21-18-4-1-2-5-19(18)22(31)23(20(21)29-12-14-36-15-13-29)38(34,35)27-16-6-8-17(9-7-16)37(32,33)28-24-25-10-3-11-26-24/h1-11,27H,12-15H2,(H,25,26,28) |
| InChIKey | BLHMNIDJYVTXTG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 164.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|