C21H18BrFN2O4S — CID 25041348
N-(4-bromo-2-fluorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25041348) has the molecular formula C21H18BrFN2O4S and a molecular weight of 493.35 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25041348 |
| Molecular Formula | C21H18BrFN2O4S |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCCC2)=C(S(=O)(=O)Nc2ccc(Br)cc2F)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H18BrFN2O4S/c22-13-8-9-17(16(23)12-13)24-30(28,29)21-18(25-10-4-1-5-11-25)19(26)14-6-2-3-7-15(14)20(21)27/h2-3,6-9,12,24H,1,4-5,10-11H2 |
| InChIKey | NHYVADGZHOZDGR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|