C22H21FN2O4S — CID 25044666
N-[(4-fluorophenyl)methyl]-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25044666) has the molecular formula C22H21FN2O4S and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25044666 |
| Molecular Formula | C22H21FN2O4S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCCC2)=C(S(=O)(=O)NCc2ccc(F)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H21FN2O4S/c23-16-10-8-15(9-11-16)14-24-30(28,29)22-19(25-12-4-1-5-13-25)20(26)17-6-2-3-7-18(17)21(22)27/h2-3,6-11,24H,1,4-5,12-14H2 |
| InChIKey | CAJXWHUDMSEFJQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|