C19H22N2O5S — CID 25044281
1,4-dioxo-N-(oxolan-2-ylmethyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25044281) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 1,4-dioxo-N-(oxolan-2-ylmethyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | 1,4-dioxo-N-(oxolan-2-ylmethyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25044281 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1,4-dioxo-N-(oxolan-2-ylmethyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCC2)=C(S(=O)(=O)NCC2CCCO2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H22N2O5S/c22-17-14-7-1-2-8-15(14)18(23)19(16(17)21-9-3-4-10-21)27(24,25)20-12-13-6-5-11-26-13/h1-2,7-8,13,20H,3-6,9-12H2 |
| InChIKey | BFNLUDPFWMKTSS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|