C24H26N2O5S — CID 25034980
N-[(4-methoxyphenyl)methyl]-3-(4-methylpiperidin-1-yl)-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25034980) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-3-(4-methylpiperidin-1-yl)-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-3-(4-methylpiperidin-1-yl)-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25034980 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-3-(4-methylpiperidin-1-yl)-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)C2=C(N3CCC(C)CC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H26N2O5S/c1-16-11-13-26(14-12-16)21-22(27)19-5-3-4-6-20(19)23(28)24(21)32(29,30)25-15-17-7-9-18(31-2)10-8-17/h3-10,16,25H,11-15H2,1-2H3 |
| InChIKey | MEJDRRJNNFPOMM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|