C25H26N2O6S — CID 25043111
ethyl 4-[[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]sulfonylamino]benzoate (PubChem CID 25043111) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is ethyl 4-[[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]sulfonylamino]benzoate.
| Compound Name | ethyl 4-[[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25043111 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | ethyl 4-[[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)C2=C(N3CCCCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-2-33-25(30)17-11-13-18(14-12-17)26-34(31,32)24-21(27-15-7-3-4-8-16-27)22(28)19-9-5-6-10-20(19)23(24)29/h5-6,9-14,26H,2-4,7-8,15-16H2,1H3 |
| InChIKey | JVZMCVAPVYQZPD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|