C22H29N3O4S — CID 23932334
2-(azepan-1-yl)-3-(4-ethylpiperazin-1-yl)sulfonylnaphthalene-1,4-dione (PubChem CID 23932334) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-(azepan-1-yl)-3-(4-ethylpiperazin-1-yl)sulfonylnaphthalene-1,4-dione.
| Compound Name | 2-(azepan-1-yl)-3-(4-ethylpiperazin-1-yl)sulfonylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 23932334 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-(azepan-1-yl)-3-(4-ethylpiperazin-1-yl)sulfonylnaphthalene-1,4-dione |
| SMILES | CCN1CCN(S(=O)(=O)C2=C(N3CCCCCC3)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H29N3O4S/c1-2-23-13-15-25(16-14-23)30(28,29)22-19(24-11-7-3-4-8-12-24)20(26)17-9-5-6-10-18(17)21(22)27/h5-6,9-10H,2-4,7-8,11-16H2,1H3 |
| InChIKey | VYYDZLUCFXXGQV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|