C27H19N3O5S — CID 25044036
N-[2-[4-(benzenesulfonamido)phenyl]-1,3-dioxoisoindol-5-yl]benzamide (PubChem CID 25044036) has the molecular formula C27H19N3O5S and a molecular weight of 497.53 g/mol. Its IUPAC name is N-[2-[4-(benzenesulfonamido)phenyl]-1,3-dioxoisoindol-5-yl]benzamide.
| Compound Name | N-[2-[4-(benzenesulfonamido)phenyl]-1,3-dioxoisoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 25044036 |
| Molecular Formula | C27H19N3O5S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | N-[2-[4-(benzenesulfonamido)phenyl]-1,3-dioxoisoindol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(c1ccc(NS(=O)(=O)c3ccccc3)cc1)C2=O)c1ccccc1 |
| InChI | InChI=1S/C27H19N3O5S/c31-25(18-7-3-1-4-8-18)28-20-13-16-23-24(17-20)27(33)30(26(23)32)21-14-11-19(12-15-21)29-36(34,35)22-9-5-2-6-10-22/h1-17,29H,(H,28,31) |
| InChIKey | AQIHNJXCHRGPDS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|