C20H15N3O6S2 — CID 168518858
2-(1,3-dioxoisoindol-2-yl)-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 168518858) has the molecular formula C20H15N3O6S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168518858 |
| Molecular Formula | C20H15N3O6S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccccc2N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H15N3O6S2/c21-30(26,27)14-11-9-13(10-12-14)22-31(28,29)18-8-4-3-7-17(18)23-19(24)15-5-1-2-6-16(15)20(23)25/h1-12,22H,(H2,21,26,27) |
| InChIKey | VDUJJZHPJLSLFW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|