C18H18N2O4S — CID 168516960
N-butyl-2-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 168516960) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-butyl-2-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | N-butyl-2-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 168516960 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-butyl-2-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N2O4S/c1-2-3-12-19-25(23,24)16-11-7-6-10-15(16)20-17(21)13-8-4-5-9-14(13)18(20)22/h4-11,19H,2-3,12H2,1H3 |
| InChIKey | DPWSGEMAECTUDB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|