C17H9ClN2O2 — CID 168518023
2-(3-chloroisoquinolin-7-yl)isoindole-1,3-dione (PubChem CID 168518023) has the molecular formula C17H9ClN2O2 and a molecular weight of 308.72 g/mol. Its IUPAC name is 2-(3-chloroisoquinolin-7-yl)isoindole-1,3-dione.
| Compound Name | 2-(3-chloroisoquinolin-7-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518023 |
| Molecular Formula | C17H9ClN2O2 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-(3-chloroisoquinolin-7-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc2cc(Cl)ncc2c1 |
| InChI | InChI=1S/C17H9ClN2O2/c18-15-8-10-5-6-12(7-11(10)9-19-15)20-16(21)13-3-1-2-4-14(13)17(20)22/h1-9H |
| InChIKey | NXTBRZCOSTWYRU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|