C24H15NO2 — CID 831037
2-(2-naphthyl)-6,7-dihydro-1H-indeno[6,7,1-def]isoquinoline-1,3(2H)-dione (PubChem CID 831037) has the molecular formula C24H15NO2 and a molecular weight of 349.40 g/mol. Its IUPAC name is 6-naphthalen-2-yl-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 2-(2-naphthyl)-6,7-dihydro-1H-indeno[6,7,1-def]isoquinoline-1,3(2H)-dione |
|---|---|
| PubChem CID | 831037 |
| Molecular Formula | C24H15NO2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 6-naphthalen-2-yl-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | C1CC2=CC=C3C4=C(C=CC1=C24)C(=O)N(C3=O)C5=CC6=CC=CC=C6C=C5 |
| InChI | InChI=1S/C24H15NO2/c26-23-19-11-8-15-5-6-16-9-12-20(22(19)21(15)16)24(27)25(23)18-10-7-14-3-1-2-4-17(14)13-18/h1-4,7-13H,5-6H2 |
| InChIKey | AXTWTHAKJDGTSI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 37.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | 608 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|