C27H16N2O2 — CID 137492195
2-naphthalen-2-yl-6-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 137492195) has the molecular formula C27H16N2O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-naphthalen-2-yl-6-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-naphthalen-2-yl-6-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 137492195 |
| Molecular Formula | C27H16N2O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-naphthalen-2-yl-6-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(-c4ccccn4)ccc(c23)C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H16N2O2/c30-26-22-9-5-8-21-20(24-10-3-4-15-28-24)13-14-23(25(21)22)27(31)29(26)19-12-11-17-6-1-2-7-18(17)16-19/h1-16H |
| InChIKey | KWSOBFXLZWRXAU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|