C22H22NO4+ — CID 21417585
1,2,3-trimethoxy-11,12-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol (PubChem CID 21417585) has the molecular formula C22H22NO4+ and a molecular weight of 364.42 g/mol. Its IUPAC name is 1,2,3-trimethoxy-11,12-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol.
| Compound Name | 1,2,3-trimethoxy-11,12-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
|---|---|
| PubChem CID | 21417585 |
| Molecular Formula | C22H22NO4+ |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1,2,3-trimethoxy-11,12-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
| SMILES | COc1cc2cc[n+]3cc4c(O)cc(C)c(C)c4cc3c2c(OC)c1OC |
| InChI | InChI=1S/C22H21NO4/c1-12-8-18(24)16-11-23-7-6-14-9-19(25-3)21(26-4)22(27-5)20(14)17(23)10-15(16)13(12)2/h6-11H,1-5H3/p+1 |
| InChIKey | BQYPCCATKSFTSH-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|