C19H16NO2+ — CID 21417500
3-methoxy-12-methylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol (PubChem CID 21417500) has the molecular formula C19H16NO2+ and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-methoxy-12-methylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol.
| Compound Name | 3-methoxy-12-methylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
|---|---|
| PubChem CID | 21417500 |
| Molecular Formula | C19H16NO2+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-methoxy-12-methylisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
| SMILES | COc1ccc2c(cc[n+]3cc4c(O)ccc(C)c4cc23)c1 |
| InChI | InChI=1S/C19H15NO2/c1-12-3-6-19(21)17-11-20-8-7-13-9-14(22-2)4-5-15(13)18(20)10-16(12)17/h3-11H,1-2H3/p+1 |
| InChIKey | SSAIRYGFULQEHN-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 33.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|