C18H14BrNO3 — CID 21417543
2-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9,12-diol bromide (PubChem CID 21417543) has the molecular formula C18H14BrNO3 and a molecular weight of 372.22 g/mol. Its IUPAC name is 2-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9,12-diol bromide.
| Compound Name | 2-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9,12-diol bromide |
|---|---|
| PubChem CID | 21417543 |
| Molecular Formula | C18H14BrNO3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 2-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9,12-diol bromide |
| SMILES | COc1ccc2cc[n+]3cc4c(O)ccc(O)c4cc3c2c1.[Br-] |
| InChI | InChI=1S/C18H13NO3.BrH/c1-22-12-3-2-11-6-7-19-10-15-14(9-16(19)13(11)8-12)17(20)4-5-18(15)21;/h2-10,20H,1H3;1H |
| InChIKey | LFRYDDRCOZHYQB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 53.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|