C19H16NO3+ — CID 21417534
3,10-dimethoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-ol (PubChem CID 21417534) has the molecular formula C19H16NO3+ and a molecular weight of 306.34 g/mol. Its IUPAC name is 3,10-dimethoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-ol.
| Compound Name | 3,10-dimethoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
|---|---|
| PubChem CID | 21417534 |
| Molecular Formula | C19H16NO3+ |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3,10-dimethoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
| SMILES | COc1ccc2c(cc[n+]3cc4c(O)c(OC)ccc4cc23)c1 |
| InChI | InChI=1S/C19H15NO3/c1-22-14-4-5-15-13(9-14)7-8-20-11-16-12(10-17(15)20)3-6-18(23-2)19(16)21/h3-11H,1-2H3/p+1 |
| InChIKey | WRPAENAAMOEMAE-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|