C18H14NO6+ — CID 88823218
10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-1,2,3,4,9-pentol (PubChem CID 88823218) has the molecular formula C18H14NO6+ and a molecular weight of 340.31 g/mol. Its IUPAC name is 10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-1,2,3,4,9-pentol.
| Compound Name | 10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-1,2,3,4,9-pentol |
|---|---|
| PubChem CID | 88823218 |
| Molecular Formula | C18H14NO6+ |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-1,2,3,4,9-pentol |
| SMILES | COc1ccc2cc3c4c(O)c(O)c(O)c(O)c4cc[n+]3cc2c1O |
| InChI | InChI=1S/C18H13NO6/c1-25-12-3-2-8-6-11-13-9(15(21)17(23)18(24)16(13)22)4-5-19(11)7-10(8)14(12)20/h2-7H,1H3,(H4,20,21,22,23,24)/p+1 |
| InChIKey | VIWUFFMNSABVSA-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|