C20H16NO3+ — CID 21417491
(10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) acetate (PubChem CID 21417491) has the molecular formula C20H16NO3+ and a molecular weight of 318.35 g/mol. Its IUPAC name is (10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) acetate.
| Compound Name | (10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) acetate |
|---|---|
| PubChem CID | 21417491 |
| Molecular Formula | C20H16NO3+ |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) acetate |
| SMILES | COc1ccc2cc3c4ccccc4cc[n+]3cc2c1OC(C)=O |
| InChI | InChI=1S/C20H16NO3/c1-13(22)24-20-17-12-21-10-9-14-5-3-4-6-16(14)18(21)11-15(17)7-8-19(20)23-2/h3-12H,1-2H3/q+1 |
| InChIKey | GVECEYGBLKRHCH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 39.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|