C18H14NO4+ — CID 21417601
10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9-triol (PubChem CID 21417601) has the molecular formula C18H14NO4+ and a molecular weight of 308.31 g/mol. Its IUPAC name is 10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9-triol.
| Compound Name | 10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9-triol |
|---|---|
| PubChem CID | 21417601 |
| Molecular Formula | C18H14NO4+ |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 10-methoxyisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9-triol |
| SMILES | COc1ccc2cc3c4cc(O)c(O)cc4cc[n+]3cc2c1O |
| InChI | InChI=1S/C18H13NO4/c1-23-17-3-2-10-6-14-12-8-16(21)15(20)7-11(12)4-5-19(14)9-13(10)18(17)22/h2-9H,1H3,(H2,20,21,22)/p+1 |
| InChIKey | RSJJKQVIUIUBBM-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|