C25H27N3O5 — CID 42506820
(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5,6,7-trimethoxy-1-methylindol-2-yl)methanone (PubChem CID 42506820) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is (8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5,6,7-trimethoxy-1-methylindol-2-yl)methanone.
| Compound Name | (8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5,6,7-trimethoxy-1-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 42506820 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5,6,7-trimethoxy-1-methylindol-2-yl)methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)c1cc2cc(OC)c(OC)c(OC)c2n1C)CC3 |
| InChI | InChI=1S/C25H27N3O5/c1-27-20(10-14-11-21(31-3)23(32-4)24(33-5)22(14)27)25(29)28-9-8-19-17(13-28)16-12-15(30-2)6-7-18(16)26-19/h6-7,10-12,26H,8-9,13H2,1-5H3 |
| InChIKey | PVUJUHBRSUWFPO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|