C22H24N6O2 — CID 46969218
(7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 46969218) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 46969218 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)c1cc(C(C)(C)C)n2ncnc2n1)CC3 |
| InChI | InChI=1S/C22H24N6O2/c1-22(2,3)19-10-18(26-21-23-12-24-28(19)21)20(29)27-8-7-17-15(11-27)14-9-13(30-4)5-6-16(14)25-17/h5-6,9-10,12,25H,7-8,11H2,1-4H3 |
| InChIKey | HNGNIBPINYJGIN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|