C19H22N4O2 — CID 157058361
(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-propan-2-yl-1H-pyrazol-3-yl)methanone (PubChem CID 157058361) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-propan-2-yl-1H-pyrazol-3-yl)methanone.
| Compound Name | (8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 157058361 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)c1cc(C(C)C)[nH]n1)CC3 |
| InChI | InChI=1S/C19H22N4O2/c1-11(2)17-9-18(22-21-17)19(24)23-7-6-16-14(10-23)13-8-12(25-3)4-5-15(13)20-16/h4-5,8-9,11,20H,6-7,10H2,1-3H3,(H,21,22) |
| InChIKey | ABADHQWCMGPUJT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|