C18H20N4O4 — CID 125177573
(7S)-7-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,3-diazepane-2,4-dione (PubChem CID 125177573) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (7S)-7-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,3-diazepane-2,4-dione.
| Compound Name | (7S)-7-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,3-diazepane-2,4-dione |
|---|---|
| PubChem CID | 125177573 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (7S)-7-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1,3-diazepane-2,4-dione |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)[C@@H]1CCC(=O)NC(=O)N1)CC3 |
| InChI | InChI=1S/C18H20N4O4/c1-26-10-2-3-13-11(8-10)12-9-22(7-6-14(12)19-13)17(24)15-4-5-16(23)21-18(25)20-15/h2-3,8,15,19H,4-7,9H2,1H3,(H2,20,21,23,25)/t15-/m0/s1 |
| InChIKey | RPEKHELDPHDLQK-HNNXBMFYSA-N |
| XLogP | 1.05 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|