C24H25N3O3 — CID 51502308
(3R)-3-[4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutyl]-1,3-dihydroindol-2-one (PubChem CID 51502308) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is (3R)-3-[4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutyl]-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-[4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 51502308 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (3R)-3-[4-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-4-oxobutyl]-1,3-dihydroindol-2-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(C(=O)CCC[C@H]1C(=O)Nc2ccccc21)CC3 |
| InChI | InChI=1S/C24H25N3O3/c1-30-15-9-10-21-18(13-15)19-14-27(12-11-22(19)25-21)23(28)8-4-6-17-16-5-2-3-7-20(16)26-24(17)29/h2-3,5,7,9-10,13,17,25H,4,6,8,11-12,14H2,1H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | SBXNFYQERFVUOL-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|