C18H20N2O5S — CID 91222582
2,3,4-trimethoxy-N-(1-methylindol-6-yl)benzenesulfonamide (PubChem CID 91222582) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-(1-methylindol-6-yl)benzenesulfonamide.
| Compound Name | 2,3,4-trimethoxy-N-(1-methylindol-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 91222582 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2,3,4-trimethoxy-N-(1-methylindol-6-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3ccn(C)c3c2)c(OC)c1OC |
| InChI | InChI=1S/C18H20N2O5S/c1-20-10-9-12-5-6-13(11-14(12)20)19-26(21,22)16-8-7-15(23-2)17(24-3)18(16)25-4/h5-11,19H,1-4H3 |
| InChIKey | CNGIDBFIYXTOOT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |