C22H23N3O2S — CID 11176859
N-[1-[2-(dimethylamino)ethyl]indol-6-yl]naphthalene-1-sulfonamide (PubChem CID 11176859) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]indol-6-yl]naphthalene-1-sulfonamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]indol-6-yl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 11176859 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]indol-6-yl]naphthalene-1-sulfonamide |
| SMILES | CN(C)CCn1ccc2ccc(NS(=O)(=O)c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C22H23N3O2S/c1-24(2)14-15-25-13-12-18-10-11-19(16-21(18)25)23-28(26,27)22-9-5-7-17-6-3-4-8-20(17)22/h3-13,16,23H,14-15H2,1-2H3 |
| InChIKey | MMVUKQDPMLJEFQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |