C20H24N4O — CID 119891273
4-(aminomethyl)-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]benzamide (PubChem CID 119891273) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]benzamide |
|---|---|
| PubChem CID | 119891273 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-(aminomethyl)-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]benzamide |
| SMILES | CN(C)CCn1ccc2ccc(NC(=O)c3ccc(CN)cc3)cc21 |
| InChI | InChI=1S/C20H24N4O/c1-23(2)11-12-24-10-9-16-7-8-18(13-19(16)24)22-20(25)17-5-3-15(14-21)4-6-17/h3-10,13H,11-12,14,21H2,1-2H3,(H,22,25) |
| InChIKey | QZXONHHZVZEEET-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |