C19H30Cl2N4O2 — CID 120800919
2-amino-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-2-(oxan-4-yl)acetamide;dihydrochloride (PubChem CID 120800919) has the molecular formula C19H30Cl2N4O2 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-amino-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-2-(oxan-4-yl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-2-(oxan-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120800919 |
| Molecular Formula | C19H30Cl2N4O2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-amino-N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-2-(oxan-4-yl)acetamide;dihydrochloride |
| SMILES | CN(C)CCn1ccc2ccc(NC(=O)C(N)C3CCOCC3)cc21.Cl.Cl |
| InChI | InChI=1S/C19H28N4O2.2ClH/c1-22(2)9-10-23-8-5-14-3-4-16(13-17(14)23)21-19(24)18(20)15-6-11-25-12-7-15;;/h3-5,8,13,15,18H,6-7,9-12,20H2,1-2H3,(H,21,24);2*1H |
| InChIKey | CTJYYJYXDUDOCA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |