C21H34Cl2N4O — CID 119891270
N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119891270) has the molecular formula C21H34Cl2N4O and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119891270 |
| Molecular Formula | C21H34Cl2N4O |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]indol-6-yl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccc2ccn(CCN(C)C)c2c1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C21H32N4O.2ClH/c1-16(18-5-4-9-22-15-18)13-21(26)23-19-7-6-17-8-10-25(20(17)14-19)12-11-24(2)3;;/h6-8,10,14,16,18,22H,4-5,9,11-13,15H2,1-3H3,(H,23,26);2*1H |
| InChIKey | YQDGIXDQSGIDNY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |