C20H35Cl2N3O2 — CID 119885836
N-[3-[3-(dimethylamino)propoxy]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119885836) has the molecular formula C20H35Cl2N3O2 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[3-[3-(dimethylamino)propoxy]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[3-[3-(dimethylamino)propoxy]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119885836 |
| Molecular Formula | C20H35Cl2N3O2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[3-[3-(dimethylamino)propoxy]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1cccc(OCCCN(C)C)c1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C20H33N3O2.2ClH/c1-16(17-7-5-10-21-15-17)13-20(24)22-18-8-4-9-19(14-18)25-12-6-11-23(2)3;;/h4,8-9,14,16-17,21H,5-7,10-13,15H2,1-3H3,(H,22,24);2*1H |
| InChIKey | UGNDSIYWQRYMTA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|