C17H26Cl2N4O2 — CID 119891236
N-[1-[2-(dimethylamino)ethyl]indol-6-yl]morpholine-3-carboxamide;dihydrochloride (PubChem CID 119891236) has the molecular formula C17H26Cl2N4O2 and a molecular weight of 389.33 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]indol-6-yl]morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]indol-6-yl]morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119891236 |
| Molecular Formula | C17H26Cl2N4O2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]indol-6-yl]morpholine-3-carboxamide;dihydrochloride |
| SMILES | CN(C)CCn1ccc2ccc(NC(=O)C3COCCN3)cc21.Cl.Cl |
| InChI | InChI=1S/C17H24N4O2.2ClH/c1-20(2)8-9-21-7-5-13-3-4-14(11-16(13)21)19-17(22)15-12-23-10-6-18-15;;/h3-5,7,11,15,18H,6,8-10,12H2,1-2H3,(H,19,22);2*1H |
| InChIKey | JEGARJYQIVGCJL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |