C18H20BrN3O2S — CID 11676162
4-bromo-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]benzenesulfonamide (PubChem CID 11676162) has the molecular formula C18H20BrN3O2S and a molecular weight of 422.35 g/mol. Its IUPAC name is 4-bromo-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11676162 |
| Molecular Formula | C18H20BrN3O2S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 4-bromo-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]benzenesulfonamide |
| SMILES | CN(C)CCn1ccc2cc(NS(=O)(=O)c3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C18H20BrN3O2S/c1-21(2)11-12-22-10-9-14-13-16(5-8-18(14)22)20-25(23,24)17-6-3-15(19)4-7-17/h3-10,13,20H,11-12H2,1-2H3 |
| InChIKey | BTEYITJWFOPNNC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |