C26H29N3O2S — CID 11201712
N-[1-[2-(diethylamino)ethyl]indol-5-yl]-4-phenylbenzenesulfonamide (PubChem CID 11201712) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]indol-5-yl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]indol-5-yl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 11201712 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]indol-5-yl]-4-phenylbenzenesulfonamide |
| SMILES | CCN(CC)CCn1ccc2cc(NS(=O)(=O)c3ccc(-c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C26H29N3O2S/c1-3-28(4-2)18-19-29-17-16-23-20-24(12-15-26(23)29)27-32(30,31)25-13-10-22(11-14-25)21-8-6-5-7-9-21/h5-17,20,27H,3-4,18-19H2,1-2H3 |
| InChIKey | IHTCWFQJHVITAM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |