C28H31N3O2S — CID 25184428
4-phenyl-N-[1-(3-piperidin-1-ylpropyl)indol-5-yl]benzenesulfonamide (PubChem CID 25184428) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is 4-phenyl-N-[1-(3-piperidin-1-ylpropyl)indol-5-yl]benzenesulfonamide.
| Compound Name | 4-phenyl-N-[1-(3-piperidin-1-ylpropyl)indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25184428 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 4-phenyl-N-[1-(3-piperidin-1-ylpropyl)indol-5-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(ccn2CCCN2CCCCC2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O2S/c32-34(33,27-13-10-24(11-14-27)23-8-3-1-4-9-23)29-26-12-15-28-25(22-26)16-21-31(28)20-7-19-30-17-5-2-6-18-30/h1,3-4,8-16,21-22,29H,2,5-7,17-20H2 |
| InChIKey | CGUQJAUJONKOGO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |