C27H39N5O — CID 91044427
1-[4-(dibutylamino)phenyl]-3-[1-[2-(dimethylamino)ethyl]indol-5-yl]urea (PubChem CID 91044427) has the molecular formula C27H39N5O and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-[4-(dibutylamino)phenyl]-3-[1-[2-(dimethylamino)ethyl]indol-5-yl]urea.
| Compound Name | 1-[4-(dibutylamino)phenyl]-3-[1-[2-(dimethylamino)ethyl]indol-5-yl]urea |
|---|---|
| PubChem CID | 91044427 |
| Molecular Formula | C27H39N5O |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | 1-[4-(dibutylamino)phenyl]-3-[1-[2-(dimethylamino)ethyl]indol-5-yl]urea |
| SMILES | CCCCN(CCCC)c1ccc(NC(=O)Nc2ccc3c(ccn3CCN(C)C)c2)cc1 |
| InChI | InChI=1S/C27H39N5O/c1-5-7-16-31(17-8-6-2)25-12-9-23(10-13-25)28-27(33)29-24-11-14-26-22(21-24)15-18-32(26)20-19-30(3)4/h9-15,18,21H,5-8,16-17,19-20H2,1-4H3,(H2,28,29,33) |
| InChIKey | SNBBBEMJULOWDH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|