C25H33N5O — CID 91074609
1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(3-methylpiperidin-1-yl)phenyl]urea (PubChem CID 91074609) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(3-methylpiperidin-1-yl)phenyl]urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(3-methylpiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 91074609 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(3-methylpiperidin-1-yl)phenyl]urea |
| SMILES | CC1CCCN(c2ccc(NC(=O)Nc3ccc4c(ccn4CCN(C)C)c3)cc2)C1 |
| InChI | InChI=1S/C25H33N5O/c1-19-5-4-13-30(18-19)23-9-6-21(7-10-23)26-25(31)27-22-8-11-24-20(17-22)12-14-29(24)16-15-28(2)3/h6-12,14,17,19H,4-5,13,15-16,18H2,1-3H3,(H2,26,27,31) |
| InChIKey | VTIMTVLGZTWRRW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|