C13H14N2O4 — CID 95468133
2-(3,4,5-trimethoxyphenyl)-1H-imidazole-5-carbaldehyde (PubChem CID 95468133) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-1H-imidazole-5-carbaldehyde.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-1H-imidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 95468133 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-1H-imidazole-5-carbaldehyde |
| SMILES | COc1cc(-c2ncc(C=O)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C13H14N2O4/c1-17-10-4-8(5-11(18-2)12(10)19-3)13-14-6-9(7-16)15-13/h4-7H,1-3H3,(H,14,15) |
| InChIKey | CCFISCSFBPCVOE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|